C16H23NO3S — CID 8785372
methyl 3-[2-(4-tert-butylanilino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 8785372) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is methyl 3-[2-(4-tert-butylanilino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | methyl 3-[2-(4-tert-butylanilino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 8785372 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | methyl 3-[2-(4-tert-butylanilino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | COC(=O)CCSCC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H23NO3S/c1-16(2,3)12-5-7-13(8-6-12)17-14(18)11-21-10-9-15(19)20-4/h5-8H,9-11H2,1-4H3,(H,17,18) |
| InChIKey | SVFFWJGHDPLDGO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|