C17H26N2O5S2 — CID 8785479
methyl 3-[2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl]sulfanylpropanoate (PubChem CID 8785479) has the molecular formula C17H26N2O5S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is methyl 3-[2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl]sulfanylpropanoate.
| Compound Name | methyl 3-[2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 8785479 |
| Molecular Formula | C17H26N2O5S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | methyl 3-[2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl]sulfanylpropanoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)CSCCC(=O)OC)ccc1C |
| InChI | InChI=1S/C17H26N2O5S2/c1-5-19(6-2)26(22,23)15-11-14(8-7-13(15)3)18-16(20)12-25-10-9-17(21)24-4/h7-8,11H,5-6,9-10,12H2,1-4H3,(H,18,20) |
| InChIKey | DZHOKHWJPXIQNC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|