C18H28N2O5S2 — CID 42971989
ethyl 2-[1-[3-(diethylsulfamoyl)-4-methylanilino]-1-oxopropan-2-yl]sulfanylacetate (PubChem CID 42971989) has the molecular formula C18H28N2O5S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is ethyl 2-[1-[3-(diethylsulfamoyl)-4-methylanilino]-1-oxopropan-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[1-[3-(diethylsulfamoyl)-4-methylanilino]-1-oxopropan-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 42971989 |
| Molecular Formula | C18H28N2O5S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | ethyl 2-[1-[3-(diethylsulfamoyl)-4-methylanilino]-1-oxopropan-2-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSC(C)C(=O)Nc1ccc(C)c(S(=O)(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C18H28N2O5S2/c1-6-20(7-2)27(23,24)16-11-15(10-9-13(16)4)19-18(22)14(5)26-12-17(21)25-8-3/h9-11,14H,6-8,12H2,1-5H3,(H,19,22) |
| InChIKey | YPXUGSOONUTWNG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |