C14H19NO4S — CID 9445287
ethyl 2-[(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl]sulfanylacetate (PubChem CID 9445287) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is ethyl 2-[(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 9445287 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | ethyl 2-[(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl]sulfanylacetate |
| SMILES | CCOC(=O)CS[C@H](C)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H19NO4S/c1-4-19-13(16)9-20-10(2)14(17)15-11-5-7-12(18-3)8-6-11/h5-8,10H,4,9H2,1-3H3,(H,15,17)/t10-/m1/s1 |
| InChIKey | LPAGNNVNEBWXJF-SNVBAGLBSA-N |
| XLogP | 2.32 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |