C17H26N3O4+ — CID 9431116
ethyl 4-[(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl]piperazin-4-ium-1-carboxylate (PubChem CID 9431116) has the molecular formula C17H26N3O4+ and a molecular weight of 336.41 g/mol. Its IUPAC name is ethyl 4-[(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl]piperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 9431116 |
| Molecular Formula | C17H26N3O4+ |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | ethyl 4-[(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl]piperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[NH+]([C@H](C)C(=O)Nc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C17H25N3O4/c1-4-24-17(22)20-11-9-19(10-12-20)13(2)16(21)18-14-5-7-15(23-3)8-6-14/h5-8,13H,4,9-12H2,1-3H3,(H,18,21)/p+1/t13-/m1/s1 |
| InChIKey | ZZEZWAURRDIQKE-CYBMUJFWSA-O |
| XLogP | 0.38 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |