C17H23N4O3+ — CID 2654330
ethyl 4-[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl]piperazin-4-ium-1-carboxylate (PubChem CID 2654330) has the molecular formula C17H23N4O3+ and a molecular weight of 331.40 g/mol. Its IUPAC name is ethyl 4-[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl]piperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 2654330 |
| Molecular Formula | C17H23N4O3+ |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | ethyl 4-[(2S)-1-(4-cyanoanilino)-1-oxopropan-2-yl]piperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[NH+]([C@@H](C)C(=O)Nc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C17H22N4O3/c1-3-24-17(23)21-10-8-20(9-11-21)13(2)16(22)19-15-6-4-14(12-18)5-7-15/h4-7,13H,3,8-11H2,1-2H3,(H,19,22)/p+1/t13-/m0/s1 |
| InChIKey | APKMJRUZJPATDH-ZDUSSCGKSA-O |
| XLogP | 0.24 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |