C16H27N3O2+2 — CID 9250047
(2R)-N-(4-ethoxyphenyl)-2-(4-methylpiperazine-1,4-diium-1-yl)propanamide (PubChem CID 9250047) has the molecular formula C16H27N3O2+2 and a molecular weight of 293.41 g/mol. Its IUPAC name is (2R)-N-(4-ethoxyphenyl)-2-(4-methylpiperazine-1,4-diium-1-yl)propanamide.
| Compound Name | (2R)-N-(4-ethoxyphenyl)-2-(4-methylpiperazine-1,4-diium-1-yl)propanamide |
|---|---|
| PubChem CID | 9250047 |
| Molecular Formula | C16H27N3O2+2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | (2R)-N-(4-ethoxyphenyl)-2-(4-methylpiperazine-1,4-diium-1-yl)propanamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H](C)[NH+]2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C16H25N3O2/c1-4-21-15-7-5-14(6-8-15)17-16(20)13(2)19-11-9-18(3)10-12-19/h5-8,13H,4,9-12H2,1-3H3,(H,17,20)/p+2/t13-/m1/s1 |
| InChIKey | JDFFFSPLTZQVFG-CYBMUJFWSA-P |
| XLogP | -1.17 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |