C15H25N3O2+2 — CID 8896631
N-(4-ethoxyphenyl)-2-(4-methylpiperazine-1,4-diium-1-yl)acetamide (PubChem CID 8896631) has the molecular formula C15H25N3O2+2 and a molecular weight of 279.38 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-(4-methylpiperazine-1,4-diium-1-yl)acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-(4-methylpiperazine-1,4-diium-1-yl)acetamide |
|---|---|
| PubChem CID | 8896631 |
| Molecular Formula | C15H25N3O2+2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-(4-methylpiperazine-1,4-diium-1-yl)acetamide |
| SMILES | CCOc1ccc(NC(=O)C[NH+]2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C15H23N3O2/c1-3-20-14-6-4-13(5-7-14)16-15(19)12-18-10-8-17(2)9-11-18/h4-7H,3,8-12H2,1-2H3,(H,16,19)/p+2 |
| InChIKey | MRWXNWVNTZWBQV-UHFFFAOYSA-P |
| XLogP | -1.56 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |