C19H29N2O4+ — CID 9444654
ethyl (3S)-1-[(2S)-1-(4-ethoxyanilino)-1-oxopropan-2-yl]piperidin-1-ium-3-carboxylate (PubChem CID 9444654) has the molecular formula C19H29N2O4+ and a molecular weight of 349.45 g/mol. Its IUPAC name is ethyl (3S)-1-[(2S)-1-(4-ethoxyanilino)-1-oxopropan-2-yl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(2S)-1-(4-ethoxyanilino)-1-oxopropan-2-yl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 9444654 |
| Molecular Formula | C19H29N2O4+ |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | ethyl (3S)-1-[(2S)-1-(4-ethoxyanilino)-1-oxopropan-2-yl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[NH+]([C@@H](C)C(=O)Nc2ccc(OCC)cc2)C1 |
| InChI | InChI=1S/C19H28N2O4/c1-4-24-17-10-8-16(9-11-17)20-18(22)14(3)21-12-6-7-15(13-21)19(23)25-5-2/h8-11,14-15H,4-7,12-13H2,1-3H3,(H,20,22)/p+1/t14-,15-/m0/s1 |
| InChIKey | ILFPOECMBOZIST-GJZGRUSLSA-O |
| XLogP | 1.27 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |