C17H22Cl3N2O3+ — CID 7858961
ethyl (3R)-1-[(2S)-1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl]piperidin-1-ium-3-carboxylate (PubChem CID 7858961) has the molecular formula C17H22Cl3N2O3+ and a molecular weight of 408.73 g/mol. Its IUPAC name is ethyl (3R)-1-[(2S)-1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(2S)-1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 7858961 |
| Molecular Formula | C17H22Cl3N2O3+ |
| Molecular Weight | 408.73 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | ethyl (3R)-1-[(2S)-1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+]([C@@H](C)C(=O)Nc2cc(Cl)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C17H21Cl3N2O3/c1-3-25-17(24)11-5-4-6-22(9-11)10(2)16(23)21-15-8-13(19)12(18)7-14(15)20/h7-8,10-11H,3-6,9H2,1-2H3,(H,21,23)/p+1/t10-,11+/m0/s1 |
| InChIKey | AQEULXLJDLNFGC-WDEREUQCSA-O |
| XLogP | 2.83 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.73 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|