C16H20Cl3N2O3+ — CID 8532819
ethyl (3R)-1-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]piperidin-1-ium-3-carboxylate (PubChem CID 8532819) has the molecular formula C16H20Cl3N2O3+ and a molecular weight of 394.71 g/mol. Its IUPAC name is ethyl (3R)-1-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 8532819 |
| Molecular Formula | C16H20Cl3N2O3+ |
| Molecular Weight | 394.71 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | ethyl (3R)-1-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+](CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C16H19Cl3N2O3/c1-2-24-16(23)10-4-3-5-21(8-10)9-15(22)20-14-7-12(18)11(17)6-13(14)19/h6-7,10H,2-5,8-9H2,1H3,(H,20,22)/p+1/t10-/m1/s1 |
| InChIKey | YBCUFVZNZMRVRW-SNVBAGLBSA-O |
| XLogP | 2.44 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.71 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|