C17H25N2O5S+ — CID 8561530
ethyl (3S)-1-[2-(2-methylsulfonylanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate (PubChem CID 8561530) has the molecular formula C17H25N2O5S+ and a molecular weight of 369.46 g/mol. Its IUPAC name is ethyl (3S)-1-[2-(2-methylsulfonylanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-(2-methylsulfonylanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 8561530 |
| Molecular Formula | C17H25N2O5S+ |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | ethyl (3S)-1-[2-(2-methylsulfonylanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[NH+](CC(=O)Nc2ccccc2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C17H24N2O5S/c1-3-24-17(21)13-7-6-10-19(11-13)12-16(20)18-14-8-4-5-9-15(14)25(2,22)23/h4-5,8-9,13H,3,6-7,10-12H2,1-2H3,(H,18,20)/p+1/t13-/m0/s1 |
| InChIKey | LNBMTOJVADPOED-ZDUSSCGKSA-O |
| XLogP | -0.11 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |