C20H32N3O5S+ — CID 8532936
ethyl (3R)-1-[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl]piperidin-1-ium-3-carboxylate (PubChem CID 8532936) has the molecular formula C20H32N3O5S+ and a molecular weight of 426.56 g/mol. Its IUPAC name is ethyl (3R)-1-[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 8532936 |
| Molecular Formula | C20H32N3O5S+ |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | ethyl (3R)-1-[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+](CC(=O)Nc2cccc(S(=O)(=O)N(CC)CC)c2)C1 |
| InChI | InChI=1S/C20H31N3O5S/c1-4-23(5-2)29(26,27)18-11-7-10-17(13-18)21-19(24)15-22-12-8-9-16(14-22)20(25)28-6-3/h7,10-11,13,16H,4-6,8-9,12,14-15H2,1-3H3,(H,21,24)/p+1/t16-/m1/s1 |
| InChIKey | OEKXXKRFZCPUDJ-MRXNPFEDSA-O |
| XLogP | 0.51 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |