C22H25N2O4+ — CID 8546924
ethyl (3R)-1-[2-(dibenzofuran-2-ylamino)-2-oxoethyl]piperidin-1-ium-3-carboxylate (PubChem CID 8546924) has the molecular formula C22H25N2O4+ and a molecular weight of 381.45 g/mol. Its IUPAC name is ethyl (3R)-1-[2-(dibenzofuran-2-ylamino)-2-oxoethyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-(dibenzofuran-2-ylamino)-2-oxoethyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 8546924 |
| Molecular Formula | C22H25N2O4+ |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | ethyl (3R)-1-[2-(dibenzofuran-2-ylamino)-2-oxoethyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+](CC(=O)Nc2ccc3oc4ccccc4c3c2)C1 |
| InChI | InChI=1S/C22H24N2O4/c1-2-27-22(26)15-6-5-11-24(13-15)14-21(25)23-16-9-10-20-18(12-16)17-7-3-4-8-19(17)28-20/h3-4,7-10,12,15H,2,5-6,11,13-14H2,1H3,(H,23,25)/p+1/t15-/m1/s1 |
| InChIKey | BYGLFYAACJYAGL-OAHLLOKOSA-O |
| XLogP | 2.38 |
| TPSA | 72.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |