C18H25N2O5+ — CID 8532996
ethyl (3S)-1-[2-(2-methoxycarbonylanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate (PubChem CID 8532996) has the molecular formula C18H25N2O5+ and a molecular weight of 349.41 g/mol. Its IUPAC name is ethyl (3S)-1-[2-(2-methoxycarbonylanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-(2-methoxycarbonylanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 8532996 |
| Molecular Formula | C18H25N2O5+ |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | ethyl (3S)-1-[2-(2-methoxycarbonylanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[NH+](CC(=O)Nc2ccccc2C(=O)OC)C1 |
| InChI | InChI=1S/C18H24N2O5/c1-3-25-17(22)13-7-6-10-20(11-13)12-16(21)19-15-9-5-4-8-14(15)18(23)24-2/h4-5,8-9,13H,3,6-7,10-12H2,1-2H3,(H,19,21)/p+1/t13-/m0/s1 |
| InChIKey | IVTJXZOHYHAKJA-ZDUSSCGKSA-O |
| XLogP | 0.27 |
| TPSA | 86.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |