C20H29N2O3+ — CID 11940744
ethyl 2-[[2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]benzoate (PubChem CID 11940744) has the molecular formula C20H29N2O3+ and a molecular weight of 345.46 g/mol. Its IUPAC name is ethyl 2-[[2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 11940744 |
| Molecular Formula | C20H29N2O3+ |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | ethyl 2-[[2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C[NH+]1CC[C@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C20H28N2O3/c1-2-25-20(24)17-9-5-6-10-18(17)21-19(23)14-22-12-11-15-7-3-4-8-16(15)13-22/h5-6,9-10,15-16H,2-4,7-8,11-14H2,1H3,(H,21,23)/p+1/t15-,16-/m1/s1 |
| InChIKey | VDUCVWGPDSVYLF-HZPDHXFCSA-O |
| XLogP | 1.90 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |