C18H27N2O2+ — CID 11920704
2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 11920704) has the molecular formula C18H27N2O2+ and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 11920704 |
| Molecular Formula | C18H27N2O2+ |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)C[NH+]1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C18H26N2O2/c1-22-17-9-5-4-8-16(17)19-18(21)13-20-11-10-14-6-2-3-7-15(14)12-20/h4-5,8-9,14-15H,2-3,6-7,10-13H2,1H3,(H,19,21)/p+1/t14-,15+/m0/s1 |
| InChIKey | WBORWTJDPUEWCA-LSDHHAIUSA-O |
| XLogP | 1.73 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |