C21H33N2O+ — CID 11940612
2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2,6-diethylphenyl)acetamide (PubChem CID 11940612) has the molecular formula C21H33N2O+ and a molecular weight of 329.51 g/mol. Its IUPAC name is 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 11940612 |
| Molecular Formula | C21H33N2O+ |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C[NH+]1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C21H32N2O/c1-3-16-10-7-11-17(4-2)21(16)22-20(24)15-23-13-12-18-8-5-6-9-19(18)14-23/h7,10-11,18-19H,3-6,8-9,12-15H2,1-2H3,(H,22,24)/p+1/t18-,19+/m0/s1 |
| InChIKey | DKCNFWQHHWBOFX-RBUKOAKNSA-O |
| XLogP | 2.84 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |