C21H29N2O5+ — CID 11940620
dimethyl 2-[[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 11940620) has the molecular formula C21H29N2O5+ and a molecular weight of 389.47 g/mol. Its IUPAC name is dimethyl 2-[[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 11940620 |
| Molecular Formula | C21H29N2O5+ |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | dimethyl 2-[[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)C[NH+]2CC[C@@H]3CCCC[C@@H]3C2)c1 |
| InChI | InChI=1S/C21H28N2O5/c1-27-20(25)15-7-8-17(21(26)28-2)18(11-15)22-19(24)13-23-10-9-14-5-3-4-6-16(14)12-23/h7-8,11,14,16H,3-6,9-10,12-13H2,1-2H3,(H,22,24)/p+1/t14-,16+/m0/s1 |
| InChIKey | CIUBJTWIFHDJKL-GOEBONIOSA-O |
| XLogP | 1.29 |
| TPSA | 86.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |