C18H26ClN2O3S+ — CID 11920500
2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2-chloro-5-methylsulfonylphenyl)acetamide (PubChem CID 11920500) has the molecular formula C18H26ClN2O3S+ and a molecular weight of 385.94 g/mol. Its IUPAC name is 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2-chloro-5-methylsulfonylphenyl)acetamide.
| Compound Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2-chloro-5-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 11920500 |
| Molecular Formula | C18H26ClN2O3S+ |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2-chloro-5-methylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C[NH+]2CC[C@H]3CCCC[C@@H]3C2)c1 |
| InChI | InChI=1S/C18H25ClN2O3S/c1-25(23,24)15-6-7-16(19)17(10-15)20-18(22)12-21-9-8-13-4-2-3-5-14(13)11-21/h6-7,10,13-14H,2-5,8-9,11-12H2,1H3,(H,20,22)/p+1/t13-,14-/m1/s1 |
| InChIKey | WWKSBGCQEMOYDV-ZIAGYGMSSA-O |
| XLogP | 1.78 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |