C18H26ClN2O2+ — CID 11920791
2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(3-chloro-4-methoxyphenyl)acetamide (PubChem CID 11920791) has the molecular formula C18H26ClN2O2+ and a molecular weight of 337.87 g/mol. Its IUPAC name is 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(3-chloro-4-methoxyphenyl)acetamide.
| Compound Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(3-chloro-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 11920791 |
| Molecular Formula | C18H26ClN2O2+ |
| Molecular Weight | 337.87 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(3-chloro-4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C[NH+]2CC[C@H]3CCCC[C@@H]3C2)cc1Cl |
| InChI | InChI=1S/C18H25ClN2O2/c1-23-17-7-6-15(10-16(17)19)20-18(22)12-21-9-8-13-4-2-3-5-14(13)11-21/h6-7,10,13-14H,2-5,8-9,11-12H2,1H3,(H,20,22)/p+1/t13-,14-/m1/s1 |
| InChIKey | TZCTZRCNJIEPCK-ZIAGYGMSSA-O |
| XLogP | 2.38 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.87 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |