C14H19ClFN2O+ — CID 2681737
N-(3-chloro-4-fluorophenyl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]acetamide (PubChem CID 2681737) has the molecular formula C14H19ClFN2O+ and a molecular weight of 285.77 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2681737 |
| Molecular Formula | C14H19ClFN2O+ |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]acetamide |
| SMILES | C[C@@H]1CCC[NH+](CC(=O)Nc2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H18ClFN2O/c1-10-3-2-6-18(8-10)9-14(19)17-11-4-5-13(16)12(15)7-11/h4-5,7,10H,2-3,6,8-9H2,1H3,(H,17,19)/p+1/t10-/m1/s1 |
| InChIKey | GHJZONQFUUHJOS-SNVBAGLBSA-O |
| XLogP | 1.73 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |