C19H30N3O3S+ — CID 7434576
2-[(3R)-3-methylpiperidin-1-ium-1-yl]-N-(4-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 7434576) has the molecular formula C19H30N3O3S+ and a molecular weight of 380.53 g/mol. Its IUPAC name is 2-[(3R)-3-methylpiperidin-1-ium-1-yl]-N-(4-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(3R)-3-methylpiperidin-1-ium-1-yl]-N-(4-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 7434576 |
| Molecular Formula | C19H30N3O3S+ |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-[(3R)-3-methylpiperidin-1-ium-1-yl]-N-(4-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | C[C@@H]1CCC[NH+](CC(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C19H29N3O3S/c1-16-6-5-11-21(14-16)15-19(23)20-17-7-9-18(10-8-17)26(24,25)22-12-3-2-4-13-22/h7-10,16H,2-6,11-15H2,1H3,(H,20,23)/p+1/t16-/m1/s1 |
| InChIKey | QWXDOPPWBAQDGV-MRXNPFEDSA-O |
| XLogP | 1.11 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |