C20H32N3O3S+ — CID 6972133
N-[4-(cyclohexylsulfamoyl)phenyl]-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide (PubChem CID 6972133) has the molecular formula C20H32N3O3S+ and a molecular weight of 394.56 g/mol. Its IUPAC name is N-[4-(cyclohexylsulfamoyl)phenyl]-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide.
| Compound Name | N-[4-(cyclohexylsulfamoyl)phenyl]-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 6972133 |
| Molecular Formula | C20H32N3O3S+ |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | N-[4-(cyclohexylsulfamoyl)phenyl]-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide |
| SMILES | C[C@H]1CCC[NH+](CC(=O)Nc2ccc(S(=O)(=O)NC3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C20H31N3O3S/c1-16-6-5-13-23(14-16)15-20(24)21-17-9-11-19(12-10-17)27(25,26)22-18-7-3-2-4-8-18/h9-12,16,18,22H,2-8,13-15H2,1H3,(H,21,24)/p+1/t16-/m0/s1 |
| InChIKey | DNKIFNPZZCGATF-INIZCTEOSA-O |
| XLogP | 1.55 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |