C33H48N4O6S2 — CID 4629962
N,N'-bis[4-(cyclohexylsulfamoyl)phenyl]nonanediamide (PubChem CID 4629962) has the molecular formula C33H48N4O6S2 and a molecular weight of 660.90 g/mol. Its IUPAC name is N,N'-bis[4-(cyclohexylsulfamoyl)phenyl]nonanediamide.
| Compound Name | N,N'-bis[4-(cyclohexylsulfamoyl)phenyl]nonanediamide |
|---|---|
| PubChem CID | 4629962 |
| Molecular Formula | C33H48N4O6S2 |
| Molecular Weight | 660.90 g/mol |
| Exact Mass | 660.30 |
| IUPAC Name | N,N'-bis[4-(cyclohexylsulfamoyl)phenyl]nonanediamide |
| SMILES | O=C(CCCCCCCC(=O)Nc1ccc(S(=O)(=O)NC2CCCCC2)cc1)Nc1ccc(S(=O)(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C33H48N4O6S2/c38-32(34-26-18-22-30(23-19-26)44(40,41)36-28-12-6-4-7-13-28)16-10-2-1-3-11-17-33(39)35-27-20-24-31(25-21-27)45(42,43)37-29-14-8-5-9-15-29/h18-25,28-29,36-37H,1-17H2,(H,34,38)(H,35,39) |
| InChIKey | QBSSFJOHPMPGRF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.90 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|