C21H25FN2O3S — CID 126248632
3-[4-(cyclohexylsulfamoyl)phenyl]-N-(4-fluorophenyl)propanamide (PubChem CID 126248632) has the molecular formula C21H25FN2O3S and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-[4-(cyclohexylsulfamoyl)phenyl]-N-(4-fluorophenyl)propanamide.
| Compound Name | 3-[4-(cyclohexylsulfamoyl)phenyl]-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 126248632 |
| Molecular Formula | C21H25FN2O3S |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-[4-(cyclohexylsulfamoyl)phenyl]-N-(4-fluorophenyl)propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)NC2CCCCC2)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FN2O3S/c22-17-9-11-18(12-10-17)23-21(25)15-8-16-6-13-20(14-7-16)28(26,27)24-19-4-2-1-3-5-19/h6-7,9-14,19,24H,1-5,8,15H2,(H,23,25) |
| InChIKey | VBJDRWQVFSHBJI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |