C16H16FNO3S — CID 18195960
3-(4-fluorophenyl)-N-(4-methylsulfonylphenyl)propanamide (PubChem CID 18195960) has the molecular formula C16H16FNO3S and a molecular weight of 321.37 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(4-methylsulfonylphenyl)propanamide.
| Compound Name | 3-(4-fluorophenyl)-N-(4-methylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 18195960 |
| Molecular Formula | C16H16FNO3S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(4-methylsulfonylphenyl)propanamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)CCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H16FNO3S/c1-22(20,21)15-9-7-14(8-10-15)18-16(19)11-4-12-2-5-13(17)6-3-12/h2-3,5-10H,4,11H2,1H3,(H,18,19) |
| InChIKey | DUCNMTZZGFJUTC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |