C20H25N3O5S2 — CID 55959827
3-[4-(cyclopropylsulfamoyl)phenyl]-N-[4-(ethylsulfonylamino)phenyl]propanamide (PubChem CID 55959827) has the molecular formula C20H25N3O5S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-[4-(cyclopropylsulfamoyl)phenyl]-N-[4-(ethylsulfonylamino)phenyl]propanamide.
| Compound Name | 3-[4-(cyclopropylsulfamoyl)phenyl]-N-[4-(ethylsulfonylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 55959827 |
| Molecular Formula | C20H25N3O5S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 3-[4-(cyclopropylsulfamoyl)phenyl]-N-[4-(ethylsulfonylamino)phenyl]propanamide |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)CCc2ccc(S(=O)(=O)NC3CC3)cc2)cc1 |
| InChI | InChI=1S/C20H25N3O5S2/c1-2-29(25,26)22-17-8-6-16(7-9-17)21-20(24)14-5-15-3-12-19(13-4-15)30(27,28)23-18-10-11-18/h3-4,6-9,12-13,18,22-23H,2,5,10-11,14H2,1H3,(H,21,24) |
| InChIKey | AUSXDITXSNXXKH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |