C22H29N3O5S2 — CID 30829010
N-[3-(butylsulfamoyl)phenyl]-3-[4-(cyclopropylsulfamoyl)phenyl]propanamide (PubChem CID 30829010) has the molecular formula C22H29N3O5S2 and a molecular weight of 479.62 g/mol. Its IUPAC name is N-[3-(butylsulfamoyl)phenyl]-3-[4-(cyclopropylsulfamoyl)phenyl]propanamide.
| Compound Name | N-[3-(butylsulfamoyl)phenyl]-3-[4-(cyclopropylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 30829010 |
| Molecular Formula | C22H29N3O5S2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-[3-(butylsulfamoyl)phenyl]-3-[4-(cyclopropylsulfamoyl)phenyl]propanamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)CCc2ccc(S(=O)(=O)NC3CC3)cc2)c1 |
| InChI | InChI=1S/C22H29N3O5S2/c1-2-3-15-23-31(27,28)21-6-4-5-19(16-21)24-22(26)14-9-17-7-12-20(13-8-17)32(29,30)25-18-10-11-18/h4-8,12-13,16,18,23,25H,2-3,9-11,14-15H2,1H3,(H,24,26) |
| InChIKey | KRXVSFPVVVESGS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|