C15H21ClN2O3S — CID 126830291
N-[3-(butylsulfamoyl)phenyl]-3-chlorocyclobutane-1-carboxamide (PubChem CID 126830291) has the molecular formula C15H21ClN2O3S and a molecular weight of 344.86 g/mol. Its IUPAC name is N-[3-(butylsulfamoyl)phenyl]-3-chlorocyclobutane-1-carboxamide.
| Compound Name | N-[3-(butylsulfamoyl)phenyl]-3-chlorocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 126830291 |
| Molecular Formula | C15H21ClN2O3S |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-[3-(butylsulfamoyl)phenyl]-3-chlorocyclobutane-1-carboxamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)C2CC(Cl)C2)c1 |
| InChI | InChI=1S/C15H21ClN2O3S/c1-2-3-7-17-22(20,21)14-6-4-5-13(10-14)18-15(19)11-8-12(16)9-11/h4-6,10-12,17H,2-3,7-9H2,1H3,(H,18,19) |
| InChIKey | BEHJNUYBNCZASP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|