C16H27N2O6PS — CID 3854038
N-[3-(butylsulfamoyl)phenyl]-2-diethoxyphosphorylacetamide (PubChem CID 3854038) has the molecular formula C16H27N2O6PS and a molecular weight of 406.44 g/mol. Its IUPAC name is N-[3-(butylsulfamoyl)phenyl]-2-diethoxyphosphorylacetamide.
| Compound Name | N-[3-(butylsulfamoyl)phenyl]-2-diethoxyphosphorylacetamide |
|---|---|
| PubChem CID | 3854038 |
| Molecular Formula | C16H27N2O6PS |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[3-(butylsulfamoyl)phenyl]-2-diethoxyphosphorylacetamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)CP(=O)(OCC)OCC)c1 |
| InChI | InChI=1S/C16H27N2O6PS/c1-4-7-11-17-26(21,22)15-10-8-9-14(12-15)18-16(19)13-25(20,23-5-2)24-6-3/h8-10,12,17H,4-7,11,13H2,1-3H3,(H,18,19) |
| InChIKey | OZONPDWUGRUWNR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|