C18H23N3O5S — CID 38748493
N-[3-[3-(butylsulfamoyl)anilino]-3-oxopropyl]furan-3-carboxamide (PubChem CID 38748493) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-[3-[3-(butylsulfamoyl)anilino]-3-oxopropyl]furan-3-carboxamide.
| Compound Name | N-[3-[3-(butylsulfamoyl)anilino]-3-oxopropyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 38748493 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-[3-[3-(butylsulfamoyl)anilino]-3-oxopropyl]furan-3-carboxamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)CCNC(=O)c2ccoc2)c1 |
| InChI | InChI=1S/C18H23N3O5S/c1-2-3-9-20-27(24,25)16-6-4-5-15(12-16)21-17(22)7-10-19-18(23)14-8-11-26-13-14/h4-6,8,11-13,20H,2-3,7,9-10H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | OYWKBNFGFSXDCX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|