C15H24N4O4S — CID 119465943
N'-[3-(2-aminoethylsulfamoyl)phenyl]-N-ethylpentanediamide (PubChem CID 119465943) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is N'-[3-(2-aminoethylsulfamoyl)phenyl]-N-ethylpentanediamide.
| Compound Name | N'-[3-(2-aminoethylsulfamoyl)phenyl]-N-ethylpentanediamide |
|---|---|
| PubChem CID | 119465943 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N'-[3-(2-aminoethylsulfamoyl)phenyl]-N-ethylpentanediamide |
| SMILES | CCNC(=O)CCCC(=O)Nc1cccc(S(=O)(=O)NCCN)c1 |
| InChI | InChI=1S/C15H24N4O4S/c1-2-17-14(20)7-4-8-15(21)19-12-5-3-6-13(11-12)24(22,23)18-10-9-16/h3,5-6,11,18H,2,4,7-10,16H2,1H3,(H,17,20)(H,19,21) |
| InChIKey | NNIICIFVOANUHV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |