C15H26ClN3O5S2 — CID 119465372
N-[3-(2-aminoethylsulfamoyl)phenyl]-2-pentylsulfonylacetamide;hydrochloride (PubChem CID 119465372) has the molecular formula C15H26ClN3O5S2 and a molecular weight of 427.98 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-2-pentylsulfonylacetamide;hydrochloride.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-pentylsulfonylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119465372 |
| Molecular Formula | C15H26ClN3O5S2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-pentylsulfonylacetamide;hydrochloride |
| SMILES | CCCCCS(=O)(=O)CC(=O)Nc1cccc(S(=O)(=O)NCCN)c1.Cl |
| InChI | InChI=1S/C15H25N3O5S2.ClH/c1-2-3-4-10-24(20,21)12-15(19)18-13-6-5-7-14(11-13)25(22,23)17-9-8-16;/h5-7,11,17H,2-4,8-10,12,16H2,1H3,(H,18,19);1H |
| InChIKey | KTYJNMISSGASRW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|