C14H21ClN4O4S — CID 119465414
N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(2-oxopyrrolidin-1-yl)acetamide;hydrochloride (PubChem CID 119465414) has the molecular formula C14H21ClN4O4S and a molecular weight of 376.87 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(2-oxopyrrolidin-1-yl)acetamide;hydrochloride.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(2-oxopyrrolidin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119465414 |
| Molecular Formula | C14H21ClN4O4S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(2-oxopyrrolidin-1-yl)acetamide;hydrochloride |
| SMILES | Cl.NCCNS(=O)(=O)c1cccc(NC(=O)CN2CCCC2=O)c1 |
| InChI | InChI=1S/C14H20N4O4S.ClH/c15-6-7-16-23(21,22)12-4-1-3-11(9-12)17-13(19)10-18-8-2-5-14(18)20;/h1,3-4,9,16H,2,5-8,10,15H2,(H,17,19);1H |
| InChIKey | GRNALWKXNJSZTB-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |