C15H26ClN3O3S — CID 119466058
N-[3-(2-aminoethylsulfamoyl)phenyl]-3,4-dimethylpentanamide;hydrochloride (PubChem CID 119466058) has the molecular formula C15H26ClN3O3S and a molecular weight of 363.91 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-3,4-dimethylpentanamide;hydrochloride.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-3,4-dimethylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119466058 |
| Molecular Formula | C15H26ClN3O3S |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-3,4-dimethylpentanamide;hydrochloride |
| SMILES | CC(C)C(C)CC(=O)Nc1cccc(S(=O)(=O)NCCN)c1.Cl |
| InChI | InChI=1S/C15H25N3O3S.ClH/c1-11(2)12(3)9-15(19)18-13-5-4-6-14(10-13)22(20,21)17-8-7-16;/h4-6,10-12,17H,7-9,16H2,1-3H3,(H,18,19);1H |
| InChIKey | GCMQDDAQPZZBEN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |