C12H19N3O4S — CID 119466051
N-[3-(2-aminoethylsulfamoyl)phenyl]-2-methoxypropanamide (PubChem CID 119466051) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-2-methoxypropanamide.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-methoxypropanamide |
|---|---|
| PubChem CID | 119466051 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-methoxypropanamide |
| SMILES | COC(C)C(=O)Nc1cccc(S(=O)(=O)NCCN)c1 |
| InChI | InChI=1S/C12H19N3O4S/c1-9(19-2)12(16)15-10-4-3-5-11(8-10)20(17,18)14-7-6-13/h3-5,8-9,14H,6-7,13H2,1-2H3,(H,15,16) |
| InChIKey | AQSWKNGWKTWMHI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |