C18H23N3O5S — CID 119465897
N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(4-methoxyphenoxy)propanamide (PubChem CID 119465897) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(4-methoxyphenoxy)propanamide.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(4-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 119465897 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(4-methoxyphenoxy)propanamide |
| SMILES | COc1ccc(OC(C)C(=O)Nc2cccc(S(=O)(=O)NCCN)c2)cc1 |
| InChI | InChI=1S/C18H23N3O5S/c1-13(26-16-8-6-15(25-2)7-9-16)18(22)21-14-4-3-5-17(12-14)27(23,24)20-11-10-19/h3-9,12-13,20H,10-11,19H2,1-2H3,(H,21,22) |
| InChIKey | PKWPJSNOTZRAGL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |