C15H19N3O4S2 — CID 119465959
N-[3-(2-aminoethylsulfamoyl)phenyl]-3-methoxy-5-methylthiophene-2-carboxamide (PubChem CID 119465959) has the molecular formula C15H19N3O4S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-3-methoxy-5-methylthiophene-2-carboxamide.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-3-methoxy-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 119465959 |
| Molecular Formula | C15H19N3O4S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-3-methoxy-5-methylthiophene-2-carboxamide |
| SMILES | COc1cc(C)sc1C(=O)Nc1cccc(S(=O)(=O)NCCN)c1 |
| InChI | InChI=1S/C15H19N3O4S2/c1-10-8-13(22-2)14(23-10)15(19)18-11-4-3-5-12(9-11)24(20,21)17-7-6-16/h3-5,8-9,17H,6-7,16H2,1-2H3,(H,18,19) |
| InChIKey | QPXYXXQMXHYTGE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |