C18H24ClN3O5S — CID 119465426
N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(2-ethoxyphenoxy)acetamide;hydrochloride (PubChem CID 119465426) has the molecular formula C18H24ClN3O5S and a molecular weight of 429.93 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(2-ethoxyphenoxy)acetamide;hydrochloride.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(2-ethoxyphenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119465426 |
| Molecular Formula | C18H24ClN3O5S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-(2-ethoxyphenoxy)acetamide;hydrochloride |
| SMILES | CCOc1ccccc1OCC(=O)Nc1cccc(S(=O)(=O)NCCN)c1.Cl |
| InChI | InChI=1S/C18H23N3O5S.ClH/c1-2-25-16-8-3-4-9-17(16)26-13-18(22)21-14-6-5-7-15(12-14)27(23,24)20-11-10-19;/h3-9,12,20H,2,10-11,13,19H2,1H3,(H,21,22);1H |
| InChIKey | DXJCKJLXQRLVOX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |