C10H17ClN2O3S — CID 120998864
N-(2-aminoethyl)-3-ethoxybenzenesulfonamide;hydrochloride (PubChem CID 120998864) has the molecular formula C10H17ClN2O3S and a molecular weight of 280.78 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-ethoxybenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-3-ethoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120998864 |
| Molecular Formula | C10H17ClN2O3S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N-(2-aminoethyl)-3-ethoxybenzenesulfonamide;hydrochloride |
| SMILES | CCOc1cccc(S(=O)(=O)NCCN)c1.Cl |
| InChI | InChI=1S/C10H16N2O3S.ClH/c1-2-15-9-4-3-5-10(8-9)16(13,14)12-7-6-11;/h3-5,8,12H,2,6-7,11H2,1H3;1H |
| InChIKey | YGWUNYXMYPWJIU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |