C13H23ClN2O4S — CID 119962102
N-(3-aminopropyl)-3,4-diethoxybenzenesulfonamide;hydrochloride (PubChem CID 119962102) has the molecular formula C13H23ClN2O4S and a molecular weight of 338.86 g/mol. Its IUPAC name is N-(3-aminopropyl)-3,4-diethoxybenzenesulfonamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-3,4-diethoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119962102 |
| Molecular Formula | C13H23ClN2O4S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | N-(3-aminopropyl)-3,4-diethoxybenzenesulfonamide;hydrochloride |
| SMILES | CCOc1ccc(S(=O)(=O)NCCCN)cc1OCC.Cl |
| InChI | InChI=1S/C13H22N2O4S.ClH/c1-3-18-12-7-6-11(10-13(12)19-4-2)20(16,17)15-9-5-8-14;/h6-7,10,15H,3-5,8-9,14H2,1-2H3;1H |
| InChIKey | SLNRQLMAYBNXEC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|