C12H19ClN2O5S — CID 120706751
methyl 4-(3-aminopropylsulfamoyl)-2-methoxybenzoate;hydrochloride (PubChem CID 120706751) has the molecular formula C12H19ClN2O5S and a molecular weight of 338.81 g/mol. Its IUPAC name is methyl 4-(3-aminopropylsulfamoyl)-2-methoxybenzoate;hydrochloride.
| Compound Name | methyl 4-(3-aminopropylsulfamoyl)-2-methoxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 120706751 |
| Molecular Formula | C12H19ClN2O5S |
| Molecular Weight | 338.81 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | methyl 4-(3-aminopropylsulfamoyl)-2-methoxybenzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCCCN)cc1OC.Cl |
| InChI | InChI=1S/C12H18N2O5S.ClH/c1-18-11-8-9(4-5-10(11)12(15)19-2)20(16,17)14-7-3-6-13;/h4-5,8,14H,3,6-7,13H2,1-2H3;1H |
| InChIKey | HSRFJQWAUWBCFH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.81 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|