C13H20N2O5S — CID 61061961
methyl 5-[3-(dimethylamino)propylsulfamoyl]-2-hydroxybenzoate (PubChem CID 61061961) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is methyl 5-[3-(dimethylamino)propylsulfamoyl]-2-hydroxybenzoate.
| Compound Name | methyl 5-[3-(dimethylamino)propylsulfamoyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 61061961 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | methyl 5-[3-(dimethylamino)propylsulfamoyl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCCCN(C)C)ccc1O |
| InChI | InChI=1S/C13H20N2O5S/c1-15(2)8-4-7-14-21(18,19)10-5-6-12(16)11(9-10)13(17)20-3/h5-6,9,14,16H,4,7-8H2,1-3H3 |
| InChIKey | MKTIHKHKQPVPSC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|