C13H23N3O3S — CID 28718145
3-(aminomethyl)-N-[3-(dimethylamino)propyl]-4-methoxybenzenesulfonamide (PubChem CID 28718145) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[3-(dimethylamino)propyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-(aminomethyl)-N-[3-(dimethylamino)propyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 28718145 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3-(aminomethyl)-N-[3-(dimethylamino)propyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCN(C)C)cc1CN |
| InChI | InChI=1S/C13H23N3O3S/c1-16(2)8-4-7-15-20(17,18)12-5-6-13(19-3)11(9-12)10-14/h5-6,9,15H,4,7-8,10,14H2,1-3H3 |
| InChIKey | LUTJUEXKWVQNNY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|