C14H23ClN2O5S — CID 120716201
methyl 2-methoxy-4-[2-(propylamino)ethylsulfamoyl]benzoate;hydrochloride (PubChem CID 120716201) has the molecular formula C14H23ClN2O5S and a molecular weight of 366.87 g/mol. Its IUPAC name is methyl 2-methoxy-4-[2-(propylamino)ethylsulfamoyl]benzoate;hydrochloride.
| Compound Name | methyl 2-methoxy-4-[2-(propylamino)ethylsulfamoyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 120716201 |
| Molecular Formula | C14H23ClN2O5S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | methyl 2-methoxy-4-[2-(propylamino)ethylsulfamoyl]benzoate;hydrochloride |
| SMILES | CCCNCCNS(=O)(=O)c1ccc(C(=O)OC)c(OC)c1.Cl |
| InChI | InChI=1S/C14H22N2O5S.ClH/c1-4-7-15-8-9-16-22(18,19)11-5-6-12(14(17)21-3)13(10-11)20-2;/h5-6,10,15-16H,4,7-9H2,1-3H3;1H |
| InChIKey | KCYXZFVFWUNCNU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|