C12H20N2O5S — CID 120715852
methyl 2-methyl-5-[2-(propylamino)ethylsulfamoyl]furan-3-carboxylate (PubChem CID 120715852) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is methyl 2-methyl-5-[2-(propylamino)ethylsulfamoyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[2-(propylamino)ethylsulfamoyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 120715852 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | methyl 2-methyl-5-[2-(propylamino)ethylsulfamoyl]furan-3-carboxylate |
| SMILES | CCCNCCNS(=O)(=O)c1cc(C(=O)OC)c(C)o1 |
| InChI | InChI=1S/C12H20N2O5S/c1-4-5-13-6-7-14-20(16,17)11-8-10(9(2)19-11)12(15)18-3/h8,13-14H,4-7H2,1-3H3 |
| InChIKey | RUHJRDFORICNCE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|