C15H18N2O5S — CID 120715512
methyl 5-[2-(4-aminophenyl)ethylsulfamoyl]-2-methylfuran-3-carboxylate (PubChem CID 120715512) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is methyl 5-[2-(4-aminophenyl)ethylsulfamoyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[2-(4-aminophenyl)ethylsulfamoyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 120715512 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | methyl 5-[2-(4-aminophenyl)ethylsulfamoyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCCc2ccc(N)cc2)oc1C |
| InChI | InChI=1S/C15H18N2O5S/c1-10-13(15(18)21-2)9-14(22-10)23(19,20)17-8-7-11-3-5-12(16)6-4-11/h3-6,9,17H,7-8,16H2,1-2H3 |
| InChIKey | WXKHCCGSIWRBFN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|