C18H23ClN2O4S — CID 120715587
ethyl 3-[2-(4-aminophenyl)ethylsulfamoyl]-4-methylbenzoate;hydrochloride (PubChem CID 120715587) has the molecular formula C18H23ClN2O4S and a molecular weight of 398.91 g/mol. Its IUPAC name is ethyl 3-[2-(4-aminophenyl)ethylsulfamoyl]-4-methylbenzoate;hydrochloride.
| Compound Name | ethyl 3-[2-(4-aminophenyl)ethylsulfamoyl]-4-methylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 120715587 |
| Molecular Formula | C18H23ClN2O4S |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | ethyl 3-[2-(4-aminophenyl)ethylsulfamoyl]-4-methylbenzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(C)c(S(=O)(=O)NCCc2ccc(N)cc2)c1.Cl |
| InChI | InChI=1S/C18H22N2O4S.ClH/c1-3-24-18(21)15-7-4-13(2)17(12-15)25(22,23)20-11-10-14-5-8-16(19)9-6-14;/h4-9,12,20H,3,10-11,19H2,1-2H3;1H |
| InChIKey | NMCZZOMFSFMHOV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|