C14H23ClN2O4S — CID 120709189
ethyl 3-[(1-amino-2-methylpropan-2-yl)sulfamoyl]-4-methylbenzoate;hydrochloride (PubChem CID 120709189) has the molecular formula C14H23ClN2O4S and a molecular weight of 350.87 g/mol. Its IUPAC name is ethyl 3-[(1-amino-2-methylpropan-2-yl)sulfamoyl]-4-methylbenzoate;hydrochloride.
| Compound Name | ethyl 3-[(1-amino-2-methylpropan-2-yl)sulfamoyl]-4-methylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 120709189 |
| Molecular Formula | C14H23ClN2O4S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | ethyl 3-[(1-amino-2-methylpropan-2-yl)sulfamoyl]-4-methylbenzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(C)c(S(=O)(=O)NC(C)(C)CN)c1.Cl |
| InChI | InChI=1S/C14H22N2O4S.ClH/c1-5-20-13(17)11-7-6-10(2)12(8-11)21(18,19)16-14(3,4)9-15;/h6-8,16H,5,9,15H2,1-4H3;1H |
| InChIKey | OLSDWQKEHRRFPC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |